C16H25N5O6 — CID 159150951
N-[2-[2-(tert-butylamino)ethoxy]ethyl]-2-(2,4-dinitroanilino)acetamide (PubChem CID 159150951) has the molecular formula C16H25N5O6 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[2-[2-(tert-butylamino)ethoxy]ethyl]-2-(2,4-dinitroanilino)acetamide.
| Compound Name | N-[2-[2-(tert-butylamino)ethoxy]ethyl]-2-(2,4-dinitroanilino)acetamide |
|---|---|
| PubChem CID | 159150951 |
| Molecular Formula | C16H25N5O6 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[2-[2-(tert-butylamino)ethoxy]ethyl]-2-(2,4-dinitroanilino)acetamide |
| SMILES | CC(C)(C)NCCOCCNC(=O)CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N5O6/c1-16(2,3)19-7-9-27-8-6-17-15(22)11-18-13-5-4-12(20(23)24)10-14(13)21(25)26/h4-5,10,18-19H,6-9,11H2,1-3H3,(H,17,22) |
| InChIKey | KJGXPELRWAVVJK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|