C11H14ClN3O4 — CID 26448563
2-(2-chloro-4-nitroanilino)-N-(2-methoxyethyl)acetamide (PubChem CID 26448563) has the molecular formula C11H14ClN3O4 and a molecular weight of 287.70 g/mol. Its IUPAC name is 2-(2-chloro-4-nitroanilino)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(2-chloro-4-nitroanilino)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 26448563 |
| Molecular Formula | C11H14ClN3O4 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-(2-chloro-4-nitroanilino)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H14ClN3O4/c1-19-5-4-13-11(16)7-14-10-3-2-8(15(17)18)6-9(10)12/h2-3,6,14H,4-5,7H2,1H3,(H,13,16) |
| InChIKey | PETXFCMOQMGURS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|