C8H6N3O6- — CID 4738135
2-(2,4-dinitroanilino)acetate (PubChem CID 4738135) has the molecular formula C8H6N3O6- and a molecular weight of 240.15 g/mol. Its IUPAC name is 2-(2,4-dinitroanilino)acetate.
| Compound Name | 2-(2,4-dinitroanilino)acetate |
|---|---|
| PubChem CID | 4738135 |
| Molecular Formula | C8H6N3O6- |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 2-(2,4-dinitroanilino)acetate |
| SMILES | O=C([O-])CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N3O6/c12-8(13)4-9-6-2-1-5(10(14)15)3-7(6)11(16)17/h1-3,9H,4H2,(H,12,13)/p-1 |
| InChIKey | RQPREKYEHBAOAR-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|