C9H7N5O7 — CID 20833188
diazomethanone;2-(2,4-dinitroanilino)acetic acid (PubChem CID 20833188) has the molecular formula C9H7N5O7 and a molecular weight of 297.18 g/mol. Its IUPAC name is diazomethanone;2-(2,4-dinitroanilino)acetic acid.
| Compound Name | diazomethanone;2-(2,4-dinitroanilino)acetic acid |
|---|---|
| PubChem CID | 20833188 |
| Molecular Formula | C9H7N5O7 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | diazomethanone;2-(2,4-dinitroanilino)acetic acid |
| SMILES | O=C(O)CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].[N-]=[N+]=C=O |
| InChI | InChI=1S/C8H7N3O6.CN2O/c12-8(13)4-9-6-2-1-5(10(14)15)3-7(6)11(16)17;2-3-1-4/h1-3,9H,4H2,(H,12,13); |
| InChIKey | VMYWRQNVGFZFLM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 189.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|