C10H10N6O5 — CID 54153970
2-diazo-N-[2-(2,4-dinitroanilino)ethyl]acetamide (PubChem CID 54153970) has the molecular formula C10H10N6O5 and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-diazo-N-[2-(2,4-dinitroanilino)ethyl]acetamide.
| Compound Name | 2-diazo-N-[2-(2,4-dinitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 54153970 |
| Molecular Formula | C10H10N6O5 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-diazo-N-[2-(2,4-dinitroanilino)ethyl]acetamide |
| SMILES | [N-]=[N+]=CC(=O)NCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N6O5/c11-14-6-10(17)13-4-3-12-8-2-1-7(15(18)19)5-9(8)16(20)21/h1-2,5-6,12H,3-4H2,(H,13,17) |
| InChIKey | OJSWEJZIDNWRGF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|