C12H15N3O5S2 — CID 57029615
4-[2-(2,4-dinitroanilino)ethyldisulfanyl]butanal (PubChem CID 57029615) has the molecular formula C12H15N3O5S2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-[2-(2,4-dinitroanilino)ethyldisulfanyl]butanal.
| Compound Name | 4-[2-(2,4-dinitroanilino)ethyldisulfanyl]butanal |
|---|---|
| PubChem CID | 57029615 |
| Molecular Formula | C12H15N3O5S2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-[2-(2,4-dinitroanilino)ethyldisulfanyl]butanal |
| SMILES | O=CCCCSSCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O5S2/c16-6-1-2-7-21-22-8-5-13-11-4-3-10(14(17)18)9-12(11)15(19)20/h3-4,6,9,13H,1-2,5,7-8H2 |
| InChIKey | DOIQCWNQUCKHSL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|