C10H14N4O6S — CID 36729413
N-[3-(2,4-dinitroanilino)propyl]methanesulfonamide (PubChem CID 36729413) has the molecular formula C10H14N4O6S and a molecular weight of 318.31 g/mol. Its IUPAC name is N-[3-(2,4-dinitroanilino)propyl]methanesulfonamide.
| Compound Name | N-[3-(2,4-dinitroanilino)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 36729413 |
| Molecular Formula | C10H14N4O6S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-[3-(2,4-dinitroanilino)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O6S/c1-21(19,20)12-6-2-5-11-9-4-3-8(13(15)16)7-10(9)14(17)18/h3-4,7,11-12H,2,5-6H2,1H3 |
| InChIKey | OPJDPTRSGMWFEH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|