C23H34N4O14 — CID 166681912
3-[3-(2-carboxyethoxy)-2-[[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]acetyl]amino]propoxy]propanoic acid (PubChem CID 166681912) has the molecular formula C23H34N4O14 and a molecular weight of 590.54 g/mol. Its IUPAC name is 3-[3-(2-carboxyethoxy)-2-[[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]acetyl]amino]propoxy]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethoxy)-2-[[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]acetyl]amino]propoxy]propanoic acid |
|---|---|
| PubChem CID | 166681912 |
| Molecular Formula | C23H34N4O14 |
| Molecular Weight | 590.54 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 3-[3-(2-carboxyethoxy)-2-[[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]acetyl]amino]propoxy]propanoic acid |
| SMILES | O=C(O)CCOCC(COCCC(=O)O)NC(=O)COCCOCCOCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H34N4O14/c28-21(25-17(14-39-6-3-22(29)30)15-40-7-4-23(31)32)16-41-12-11-38-10-9-37-8-5-24-19-2-1-18(26(33)34)13-20(19)27(35)36/h1-2,13,17,24H,3-12,14-16H2,(H,25,28)(H,29,30)(H,31,32) |
| InChIKey | XNYHJWLRLXRQRL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 248.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.54 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|