C17H28N6O8 — CID 59257699
N-[2-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]-5-nitrophenyl]nitrous amide (PubChem CID 59257699) has the molecular formula C17H28N6O8 and a molecular weight of 444.45 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]-5-nitrophenyl]nitrous amide.
| Compound Name | N-[2-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]-5-nitrophenyl]nitrous amide |
|---|---|
| PubChem CID | 59257699 |
| Molecular Formula | C17H28N6O8 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-[2-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]-5-nitrophenyl]nitrous amide |
| SMILES | NNC(=O)CCOCCOCCOCCOCCNc1ccc([N+](=O)[O-])cc1NN=O |
| InChI | InChI=1S/C17H28N6O8/c18-20-17(24)3-5-28-7-9-30-11-12-31-10-8-29-6-4-19-15-2-1-14(23(26)27)13-16(15)21-22-25/h1-2,13,19H,3-12,18H2,(H,20,24)(H,21,25) |
| InChIKey | LEXAOFCCQYSVQD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 188.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|