C6H4N4O5 — CID 54504418
N-(2,4-dinitrophenyl)nitrous amide (PubChem CID 54504418) has the molecular formula C6H4N4O5 and a molecular weight of 212.12 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)nitrous amide.
| Compound Name | N-(2,4-dinitrophenyl)nitrous amide |
|---|---|
| PubChem CID | 54504418 |
| Molecular Formula | C6H4N4O5 |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | N-(2,4-dinitrophenyl)nitrous amide |
| SMILES | O=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4N4O5/c11-8-7-5-2-1-4(9(12)13)3-6(5)10(14)15/h1-3H,(H,7,11) |
| InChIKey | YERNCYBPSJENKN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|