C7H6N4O4 — CID 100938407
N-(dideuteriomethylideneamino)-2,4-dinitroaniline (PubChem CID 100938407) has the molecular formula C7H6N4O4 and a molecular weight of 212.16 g/mol. Its IUPAC name is N-(dideuteriomethylideneamino)-2,4-dinitroaniline.
| Compound Name | N-(dideuteriomethylideneamino)-2,4-dinitroaniline |
|---|---|
| PubChem CID | 100938407 |
| Molecular Formula | C7H6N4O4 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | N-(dideuteriomethylideneamino)-2,4-dinitroaniline |
| SMILES | [2H]C([2H])=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N4O4/c1-8-9-6-3-2-5(10(12)13)4-7(6)11(14)15/h2-4,9H,1H2/i1D2 |
| InChIKey | UEQLSLWCHGLSML-DICFDUPASA-N |
| XLogP | 1.53 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|