C12H12N4O4 — CID 159646359
benzene;(2,4-dinitrophenyl)hydrazine (PubChem CID 159646359) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is benzene;(2,4-dinitrophenyl)hydrazine.
| Compound Name | benzene;(2,4-dinitrophenyl)hydrazine |
|---|---|
| PubChem CID | 159646359 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | benzene;(2,4-dinitrophenyl)hydrazine |
| SMILES | NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].c1ccccc1 |
| InChI | InChI=1S/C6H6N4O4.C6H6/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14;1-2-4-6-5-3-1/h1-3,8H,7H2;1-6H |
| InChIKey | MQZWBBHMYKPTSC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|