C12H14N4O10 — CID 141450091
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;(2,4-dinitrophenyl)hydrazine (PubChem CID 141450091) has the molecular formula C12H14N4O10 and a molecular weight of 374.26 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;(2,4-dinitrophenyl)hydrazine.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;(2,4-dinitrophenyl)hydrazine |
|---|---|
| PubChem CID | 141450091 |
| Molecular Formula | C12H14N4O10 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;(2,4-dinitrophenyl)hydrazine |
| SMILES | NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].O=C1O[C@H]([C@@H](O)CO)C(O)=C1O |
| InChI | InChI=1S/C6H6N4O4.C6H8O6/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14;7-1-2(8)5-3(9)4(10)6(11)12-5/h1-3,8H,7H2;2,5,7-10H,1H2/t;2-,5+/m.0/s1 |
| InChIKey | HILCRPGINKWIID-MGMRMFRLSA-N |
| XLogP | -0.62 |
| TPSA | 231.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|