C6H8Cu3O14P2 — CID 173001729
tricopper;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;diphosphate (PubChem CID 173001729) has the molecular formula C6H8Cu3O14P2 and a molecular weight of 556.70 g/mol. Its IUPAC name is tricopper;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;diphosphate.
| Compound Name | tricopper;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;diphosphate |
|---|---|
| PubChem CID | 173001729 |
| Molecular Formula | C6H8Cu3O14P2 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 554.73 |
| IUPAC Name | tricopper;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;diphosphate |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1O.O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Cu+2].[Cu+2].[Cu+2] |
| InChI | InChI=1S/C6H8O6.3Cu.2H3O4P/c7-1-2(8)5-3(9)4(10)6(11)12-5;;;;2*1-5(2,3)4/h2,5,7-10H,1H2;;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6/t2-,5+;;;;;/m0...../s1 |
| InChIKey | KIWRGXOCIIAWEP-XCTPRCOBSA-H |
| XLogP | -7.06 |
| TPSA | 279.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | -7.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|