C6H8Bi2O18S3 — CID 173193760
dibismuth;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;trisulfate (PubChem CID 173193760) has the molecular formula C6H8Bi2O18S3 and a molecular weight of 882.27 g/mol. Its IUPAC name is dibismuth;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;trisulfate.
| Compound Name | dibismuth;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;trisulfate |
|---|---|
| PubChem CID | 173193760 |
| Molecular Formula | C6H8Bi2O18S3 |
| Molecular Weight | 882.27 g/mol |
| Exact Mass | 881.85 |
| IUPAC Name | dibismuth;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;trisulfate |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1O.O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[Bi+3].[Bi+3] |
| InChI | InChI=1S/C6H8O6.2Bi.3H2O4S/c7-1-2(8)5-3(9)4(10)6(11)12-5;;;3*1-5(2,3)4/h2,5,7-10H,1H2;;;3*(H2,1,2,3,4)/q;2*+3;;;/p-6/t2-,5+;;;;;/m0...../s1 |
| InChIKey | OWKKMPVWSYFNSN-XCTPRCOBSA-H |
| XLogP | -6.18 |
| TPSA | 348.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.27 |
| LogP ≤ 5 | -6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|