About trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride
trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride (PubChem CID 173003936) has the molecular formula C6H11Na3O6
and a molecular weight of 248.12 g/mol. Its IUPAC name is trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride.
Molecular Properties
| Compound Name | trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride |
| PubChem CID | 173003936 |
| Molecular Formula | C6H11Na3O6 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1O.[H-].[H-].[H-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H8O6.3Na.3H/c7-1-2(8)5-3(9)4(10)6(11)12-5;;;;;;/h2,5,7-10H,1H2;;;;;;/q;3*+1;3*-1/t2-,5+;;;;;;/m0....../s1 |
| InChIKey | VCHMIALYVUAPSD-CXJVLALHSA-N |
| XLogP | -10.06 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | -10.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride?
The IUPAC name of trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride (CID 173003936) is trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride.
What is the SMILES notation for trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride?
The canonical SMILES for trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride is O=C1O[C@H]([C@@H](O)CO)C(O)=C1O.[H-].[H-].[H-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride?
The InChIKey is VCHMIALYVUAPSD-CXJVLALHSA-N. The full InChI is InChI=1S/C6H8O6.3Na.3H/c7-1-2(8)5-3(9)4(10)6(11)12-5;;;;;;/h2,5,7-10H,1H2;;;;;;/q;3*+1;3*-1/t2-,5+;;;;;;/m0....../s1.
What are the key properties of trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride?
trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride has a molecular weight of 248.12 g/mol, XLogP of -10.06, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hydride is sourced from PubChem (CID 173003936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).