C6H11O10P — CID 174800617
(2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;phosphoric acid (PubChem CID 174800617) has the molecular formula C6H11O10P and a molecular weight of 274.12 g/mol. Its IUPAC name is (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;phosphoric acid.
| Compound Name | (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;phosphoric acid |
|---|---|
| PubChem CID | 174800617 |
| Molecular Formula | C6H11O10P |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;phosphoric acid |
| SMILES | O=C1O[C@H](C(O)CO)C(O)=C1O.O=P(O)(O)O |
| InChI | InChI=1S/C6H8O6.H3O4P/c7-1-2(8)5-3(9)4(10)6(11)12-5;1-5(2,3)4/h2,5,7-10H,1H2;(H3,1,2,3,4)/t2?,5-;/m1./s1 |
| InChIKey | DBSABEYSGXPBTA-KOCDJGNTSA-N |
| XLogP | -2.34 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|