About azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one
azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one (PubChem CID 54713594) has the molecular formula C6H12NO6+
and a molecular weight of 194.16 g/mol. Its IUPAC name is azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one.
Molecular Properties
| Compound Name | azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| PubChem CID | 54713594 |
| Molecular Formula | C6H12NO6+ |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1O.[NH4+] |
| InChI | InChI=1S/C6H8O6.H3N/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;1H3/p+1/t2-,5+;/m0./s1 |
| InChIKey | QKWNIOMGXBERHJ-RXSVEWSESA-O |
| XLogP | -1.03 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one?
The IUPAC name of azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one (CID 54713594) is azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one.
What is the SMILES notation for azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one?
The canonical SMILES for azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one is O=C1O[C@H]([C@@H](O)CO)C(O)=C1O.[NH4+].
What is the InChIKey of azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one?
The InChIKey is QKWNIOMGXBERHJ-RXSVEWSESA-O. The full InChI is InChI=1S/C6H8O6.H3N/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;1H3/p+1/t2-,5+;/m0./s1.
What are the key properties of azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one?
azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one has a molecular weight of 194.16 g/mol, XLogP of -1.03, 2 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azanium (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one is sourced from PubChem (CID 54713594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).