C6H7N4O7P — CID 23421481
[2-(2,4-dinitrophenyl)hydrazinyl]phosphonic acid (PubChem CID 23421481) has the molecular formula C6H7N4O7P and a molecular weight of 278.12 g/mol. Its IUPAC name is [2-(2,4-dinitrophenyl)hydrazinyl]phosphonic acid.
| Compound Name | [2-(2,4-dinitrophenyl)hydrazinyl]phosphonic acid |
|---|---|
| PubChem CID | 23421481 |
| Molecular Formula | C6H7N4O7P |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | [2-(2,4-dinitrophenyl)hydrazinyl]phosphonic acid |
| SMILES | O=[N+]([O-])c1ccc(NNP(=O)(O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H7N4O7P/c11-9(12)4-1-2-5(6(3-4)10(13)14)7-8-18(15,16)17/h1-3,7H,(H3,8,15,16,17) |
| InChIKey | SUZCEHJKKNTVMF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|