About (2,4-dinitrophenyl)hydrazine;propan-2-one
(2,4-dinitrophenyl)hydrazine;propan-2-one (PubChem CID 162068337) has the molecular formula C9H12N4O5
and a molecular weight of 256.22 g/mol. Its IUPAC name is (2,4-dinitrophenyl)hydrazine;propan-2-one.
Molecular Properties
| Compound Name | (2,4-dinitrophenyl)hydrazine;propan-2-one |
| PubChem CID | 162068337 |
| Molecular Formula | C9H12N4O5 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (2,4-dinitrophenyl)hydrazine;propan-2-one |
| SMILES | CC(C)=O.NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N4O4.C3H6O/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14;1-3(2)4/h1-3,8H,7H2;1-2H3 |
| InChIKey | ZASYXXGNNSUIBS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenyl)hydrazine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenyl)hydrazine;propan-2-one?
The IUPAC name of (2,4-dinitrophenyl)hydrazine;propan-2-one (CID 162068337) is (2,4-dinitrophenyl)hydrazine;propan-2-one.
What is the SMILES notation for (2,4-dinitrophenyl)hydrazine;propan-2-one?
The canonical SMILES for (2,4-dinitrophenyl)hydrazine;propan-2-one is CC(C)=O.NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of (2,4-dinitrophenyl)hydrazine;propan-2-one?
The InChIKey is ZASYXXGNNSUIBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O4.C3H6O/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14;1-3(2)4/h1-3,8H,7H2;1-2H3.
What are the key properties of (2,4-dinitrophenyl)hydrazine;propan-2-one?
(2,4-dinitrophenyl)hydrazine;propan-2-one has a molecular weight of 256.22 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenyl)hydrazine;propan-2-one is sourced from PubChem (CID 162068337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).