C11H9N4O4+ — CID 101076913
N-(2,4-dinitrophenyl)pyridin-1-ium-1-amine (PubChem CID 101076913) has the molecular formula C11H9N4O4+ and a molecular weight of 261.22 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)pyridin-1-ium-1-amine.
| Compound Name | N-(2,4-dinitrophenyl)pyridin-1-ium-1-amine |
|---|---|
| PubChem CID | 101076913 |
| Molecular Formula | C11H9N4O4+ |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-(2,4-dinitrophenyl)pyridin-1-ium-1-amine |
| SMILES | O=[N+]([O-])c1ccc(N[n+]2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9N4O4/c16-14(17)9-4-5-10(11(8-9)15(18)19)12-13-6-2-1-3-7-13/h1-8,12H/q+1 |
| InChIKey | YEGHHHQASMXKBB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|