C21H19N3O5 — CID 100986613
(2S)-2-(2,4-dinitroanilino)-1,1-diphenylpropan-1-ol (PubChem CID 100986613) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is (2S)-2-(2,4-dinitroanilino)-1,1-diphenylpropan-1-ol.
| Compound Name | (2S)-2-(2,4-dinitroanilino)-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 100986613 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (2S)-2-(2,4-dinitroanilino)-1,1-diphenylpropan-1-ol |
| SMILES | C[C@H](Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19N3O5/c1-15(22-19-13-12-18(23(26)27)14-20(19)24(28)29)21(25,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15,22,25H,1H3/t15-/m0/s1 |
| InChIKey | QZCKKOVZAZKCOK-HNNXBMFYSA-N |
| XLogP | 4.24 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|