C15H14N4O5 — CID 51984141
(2R)-2-(2,4-dinitroanilino)-N-methyl-2-phenylacetamide (PubChem CID 51984141) has the molecular formula C15H14N4O5 and a molecular weight of 330.30 g/mol. Its IUPAC name is (2R)-2-(2,4-dinitroanilino)-N-methyl-2-phenylacetamide.
| Compound Name | (2R)-2-(2,4-dinitroanilino)-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 51984141 |
| Molecular Formula | C15H14N4O5 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (2R)-2-(2,4-dinitroanilino)-N-methyl-2-phenylacetamide |
| SMILES | CNC(=O)[C@H](Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C15H14N4O5/c1-16-15(20)14(10-5-3-2-4-6-10)17-12-8-7-11(18(21)22)9-13(12)19(23)24/h2-9,14,17H,1H3,(H,16,20)/t14-/m1/s1 |
| InChIKey | ODOHECFILOSHRT-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|