C10H9N3O8 — CID 15593838
(2R)-2-(2,4-dinitroanilino)butanedioic acid (PubChem CID 15593838) has the molecular formula C10H9N3O8 and a molecular weight of 299.20 g/mol. Its IUPAC name is (2R)-2-(2,4-dinitroanilino)butanedioic acid.
| Compound Name | (2R)-2-(2,4-dinitroanilino)butanedioic acid |
|---|---|
| PubChem CID | 15593838 |
| Molecular Formula | C10H9N3O8 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (2R)-2-(2,4-dinitroanilino)butanedioic acid |
| SMILES | O=C(O)C[C@@H](Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H9N3O8/c14-9(15)4-7(10(16)17)11-6-2-1-5(12(18)19)3-8(6)13(20)21/h1-3,7,11H,4H2,(H,14,15)(H,16,17)/t7-/m1/s1 |
| InChIKey | VPBRVQFBZHIBPS-SSDOTTSWSA-N |
| XLogP | 0.84 |
| TPSA | 172.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|