C13H17N5O6 — CID 139247079
7-amino-2-(2,4-dinitroanilino)-7-iminoheptanoic acid (PubChem CID 139247079) has the molecular formula C13H17N5O6 and a molecular weight of 339.31 g/mol. Its IUPAC name is 7-amino-2-(2,4-dinitroanilino)-7-iminoheptanoic acid.
| Compound Name | 7-amino-2-(2,4-dinitroanilino)-7-iminoheptanoic acid |
|---|---|
| PubChem CID | 139247079 |
| Molecular Formula | C13H17N5O6 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 7-amino-2-(2,4-dinitroanilino)-7-iminoheptanoic acid |
| SMILES | [H]/N=C(\N)CCCCC(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C13H17N5O6/c14-12(15)4-2-1-3-10(13(19)20)16-9-6-5-8(17(21)22)7-11(9)18(23)24/h5-7,10,16H,1-4H2,(H3,14,15)(H,19,20) |
| InChIKey | CFHMNDYTRREYNU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 185.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|