C12H17ClN4O6 — CID 134346252
6-amino-2-(2,4-dinitroanilino)hexanoic acid;hydrochloride (PubChem CID 134346252) has the molecular formula C12H17ClN4O6 and a molecular weight of 348.74 g/mol. Its IUPAC name is 6-amino-2-(2,4-dinitroanilino)hexanoic acid;hydrochloride.
| Compound Name | 6-amino-2-(2,4-dinitroanilino)hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 134346252 |
| Molecular Formula | C12H17ClN4O6 |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 6-amino-2-(2,4-dinitroanilino)hexanoic acid;hydrochloride |
| SMILES | Cl.NCCCCC(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H16N4O6.ClH/c13-6-2-1-3-10(12(17)18)14-9-5-4-8(15(19)20)7-11(9)16(21)22;/h4-5,7,10,14H,1-3,6,13H2,(H,17,18);1H |
| InChIKey | XSMOBBCWFMGTRE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 161.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|