C13H16N4O7S — CID 170439793
2-[[(2S)-2-(2,4-dinitroanilino)-4-methylsulfanylbutanoyl]amino]acetic acid (PubChem CID 170439793) has the molecular formula C13H16N4O7S and a molecular weight of 372.36 g/mol. Its IUPAC name is 2-[[(2S)-2-(2,4-dinitroanilino)-4-methylsulfanylbutanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-(2,4-dinitroanilino)-4-methylsulfanylbutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 170439793 |
| Molecular Formula | C13H16N4O7S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-[[(2S)-2-(2,4-dinitroanilino)-4-methylsulfanylbutanoyl]amino]acetic acid |
| SMILES | CSCC[C@H](Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H16N4O7S/c1-25-5-4-10(13(20)14-7-12(18)19)15-9-3-2-8(16(21)22)6-11(9)17(23)24/h2-3,6,10,15H,4-5,7H2,1H3,(H,14,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | PAKATBJATRRRRC-JTQLQIEISA-N |
| XLogP | 1.24 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|