C13H19N3O6S — CID 122063020
(2S)-2-[4-(methylsulfamoyl)-2-nitroanilino]hexanoic acid (PubChem CID 122063020) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is (2S)-2-[4-(methylsulfamoyl)-2-nitroanilino]hexanoic acid.
| Compound Name | (2S)-2-[4-(methylsulfamoyl)-2-nitroanilino]hexanoic acid |
|---|---|
| PubChem CID | 122063020 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2S)-2-[4-(methylsulfamoyl)-2-nitroanilino]hexanoic acid |
| SMILES | CCCC[C@H](Nc1ccc(S(=O)(=O)NC)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C13H19N3O6S/c1-3-4-5-11(13(17)18)15-10-7-6-9(23(21,22)14-2)8-12(10)16(19)20/h6-8,11,14-15H,3-5H2,1-2H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | XUUJVNSNPCUJNL-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|