C10H13N3O6S — CID 120964478
(2R)-2-[4-(methylsulfamoyl)-2-nitroanilino]propanoic acid (PubChem CID 120964478) has the molecular formula C10H13N3O6S and a molecular weight of 303.30 g/mol. Its IUPAC name is (2R)-2-[4-(methylsulfamoyl)-2-nitroanilino]propanoic acid.
| Compound Name | (2R)-2-[4-(methylsulfamoyl)-2-nitroanilino]propanoic acid |
|---|---|
| PubChem CID | 120964478 |
| Molecular Formula | C10H13N3O6S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (2R)-2-[4-(methylsulfamoyl)-2-nitroanilino]propanoic acid |
| SMILES | CNS(=O)(=O)c1ccc(N[C@H](C)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13N3O6S/c1-6(10(14)15)12-8-4-3-7(20(18,19)11-2)5-9(8)13(16)17/h3-6,11-12H,1-2H3,(H,14,15)/t6-/m1/s1 |
| InChIKey | BYUCNUNNYNEFQN-ZCFIWIBFSA-N |
| XLogP | 0.39 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|