C18H26N4O7 — CID 165150338
2-[[2-(2,4-dinitroanilino)-4-methylpentanoyl]amino]-3-methylpentanoic acid (PubChem CID 165150338) has the molecular formula C18H26N4O7 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[[2-(2,4-dinitroanilino)-4-methylpentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-(2,4-dinitroanilino)-4-methylpentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 165150338 |
| Molecular Formula | C18H26N4O7 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[[2-(2,4-dinitroanilino)-4-methylpentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(C)C)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C18H26N4O7/c1-5-11(4)16(18(24)25)20-17(23)14(8-10(2)3)19-13-7-6-12(21(26)27)9-15(13)22(28)29/h6-7,9-11,14,16,19H,5,8H2,1-4H3,(H,20,23)(H,24,25) |
| InChIKey | IZSOFDPUHKNKCK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|