C11H9N3O6 — CID 115499965
2-(3-cyano-4-nitroanilino)butanedioic acid (PubChem CID 115499965) has the molecular formula C11H9N3O6 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2-(3-cyano-4-nitroanilino)butanedioic acid.
| Compound Name | 2-(3-cyano-4-nitroanilino)butanedioic acid |
|---|---|
| PubChem CID | 115499965 |
| Molecular Formula | C11H9N3O6 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-(3-cyano-4-nitroanilino)butanedioic acid |
| SMILES | N#Cc1cc(NC(CC(=O)O)C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9N3O6/c12-5-6-3-7(1-2-9(6)14(19)20)13-8(11(17)18)4-10(15)16/h1-3,8,13H,4H2,(H,15,16)(H,17,18) |
| InChIKey | CLRFXXZPBPKEHG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 153.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|