C13H9FN4O5 — CID 4507199
N'-(2,4-dinitrophenyl)-4-fluorobenzohydrazide (PubChem CID 4507199) has the molecular formula C13H9FN4O5 and a molecular weight of 320.24 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)-4-fluorobenzohydrazide.
| Compound Name | N'-(2,4-dinitrophenyl)-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 4507199 |
| Molecular Formula | C13H9FN4O5 |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N'-(2,4-dinitrophenyl)-4-fluorobenzohydrazide |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C13H9FN4O5/c14-9-3-1-8(2-4-9)13(19)16-15-11-6-5-10(17(20)21)7-12(11)18(22)23/h1-7,15H,(H,16,19) |
| InChIKey | BMJNJJJLJDDGBI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|