C14H9N5O5S — CID 167771264
N'-(2,4-dinitrophenyl)-1,3-benzothiazole-6-carbohydrazide (PubChem CID 167771264) has the molecular formula C14H9N5O5S and a molecular weight of 359.32 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)-1,3-benzothiazole-6-carbohydrazide.
| Compound Name | N'-(2,4-dinitrophenyl)-1,3-benzothiazole-6-carbohydrazide |
|---|---|
| PubChem CID | 167771264 |
| Molecular Formula | C14H9N5O5S |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N'-(2,4-dinitrophenyl)-1,3-benzothiazole-6-carbohydrazide |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H9N5O5S/c20-14(8-1-3-11-13(5-8)25-7-15-11)17-16-10-4-2-9(18(21)22)6-12(10)19(23)24/h1-7,16H,(H,17,20) |
| InChIKey | BKABRYCDUFBIFX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|