C13H9N3O2S — CID 112840853
N-(4-nitrophenyl)-1,3-benzothiazol-6-amine (PubChem CID 112840853) has the molecular formula C13H9N3O2S and a molecular weight of 271.30 g/mol. Its IUPAC name is N-(4-nitrophenyl)-1,3-benzothiazol-6-amine.
| Compound Name | N-(4-nitrophenyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 112840853 |
| Molecular Formula | C13H9N3O2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | N-(4-nitrophenyl)-1,3-benzothiazol-6-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccc3ncsc3c2)cc1 |
| InChI | InChI=1S/C13H9N3O2S/c17-16(18)11-4-1-9(2-5-11)15-10-3-6-12-13(7-10)19-8-14-12/h1-8,15H |
| InChIKey | OCGFTBRXYXEVBY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|