About 6-bromo-1,3-benzothiazole;nitrobenzene
6-bromo-1,3-benzothiazole;nitrobenzene (PubChem CID 160916234) has the molecular formula C13H9BrN2O2S
and a molecular weight of 337.20 g/mol. Its IUPAC name is 6-bromo-1,3-benzothiazole;nitrobenzene.
Molecular Properties
| Compound Name | 6-bromo-1,3-benzothiazole;nitrobenzene |
| PubChem CID | 160916234 |
| Molecular Formula | C13H9BrN2O2S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 6-bromo-1,3-benzothiazole;nitrobenzene |
| SMILES | Brc1ccc2ncsc2c1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C7H4BrNS.C6H5NO2/c8-5-1-2-6-7(3-5)10-4-9-6;8-7(9)6-4-2-1-3-5-6/h1-4H;1-5H |
| InChIKey | SRLAITWKRFGPQG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1,3-benzothiazole;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,3-benzothiazole;nitrobenzene?
The IUPAC name of 6-bromo-1,3-benzothiazole;nitrobenzene (CID 160916234) is 6-bromo-1,3-benzothiazole;nitrobenzene.
What is the SMILES notation for 6-bromo-1,3-benzothiazole;nitrobenzene?
The canonical SMILES for 6-bromo-1,3-benzothiazole;nitrobenzene is Brc1ccc2ncsc2c1.O=[N+]([O-])c1ccccc1.
What is the InChIKey of 6-bromo-1,3-benzothiazole;nitrobenzene?
The InChIKey is SRLAITWKRFGPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNS.C6H5NO2/c8-5-1-2-6-7(3-5)10-4-9-6;8-7(9)6-4-2-1-3-5-6/h1-4H;1-5H.
What are the key properties of 6-bromo-1,3-benzothiazole;nitrobenzene?
6-bromo-1,3-benzothiazole;nitrobenzene has a molecular weight of 337.20 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,3-benzothiazole;nitrobenzene is sourced from PubChem (CID 160916234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).