C14H9N3O4S — CID 59671611
(4-nitrophenyl) N-(1,3-benzothiazol-6-yl)carbamate (PubChem CID 59671611) has the molecular formula C14H9N3O4S and a molecular weight of 315.31 g/mol. Its IUPAC name is (4-nitrophenyl) N-(1,3-benzothiazol-6-yl)carbamate.
| Compound Name | (4-nitrophenyl) N-(1,3-benzothiazol-6-yl)carbamate |
|---|---|
| PubChem CID | 59671611 |
| Molecular Formula | C14H9N3O4S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (4-nitrophenyl) N-(1,3-benzothiazol-6-yl)carbamate |
| SMILES | O=C(Nc1ccc2ncsc2c1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H9N3O4S/c18-14(21-11-4-2-10(3-5-11)17(19)20)16-9-1-6-12-13(7-9)22-8-15-12/h1-8H,(H,16,18) |
| InChIKey | MWOARHVMROIOHN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|