C15H10N4O5 — CID 57265169
(4-nitrophenyl) N-[3-(1,2,4-oxadiazol-5-yl)phenyl]carbamate (PubChem CID 57265169) has the molecular formula C15H10N4O5 and a molecular weight of 326.27 g/mol. Its IUPAC name is (4-nitrophenyl) N-[3-(1,2,4-oxadiazol-5-yl)phenyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[3-(1,2,4-oxadiazol-5-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 57265169 |
| Molecular Formula | C15H10N4O5 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (4-nitrophenyl) N-[3-(1,2,4-oxadiazol-5-yl)phenyl]carbamate |
| SMILES | O=C(Nc1cccc(-c2ncno2)c1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H10N4O5/c20-15(23-13-6-4-12(5-7-13)19(21)22)18-11-3-1-2-10(8-11)14-16-9-17-24-14/h1-9H,(H,18,20) |
| InChIKey | MGAWWKDSRCVPPK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|