C17H10F3N3O5S — CID 58958448
(4-nitrophenyl) N-[5-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 58958448) has the molecular formula C17H10F3N3O5S and a molecular weight of 425.34 g/mol. Its IUPAC name is (4-nitrophenyl) N-[5-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | (4-nitrophenyl) N-[5-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 58958448 |
| Molecular Formula | C17H10F3N3O5S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | (4-nitrophenyl) N-[5-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | O=C(Nc1ncc(-c2cccc(OC(F)(F)F)c2)s1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H10F3N3O5S/c18-17(19,20)28-13-3-1-2-10(8-13)14-9-21-15(29-14)22-16(24)27-12-6-4-11(5-7-12)23(25)26/h1-9H,(H,21,22,24) |
| InChIKey | VYEIWPNYLMCYSD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|