C21H14F3N5O4S — CID 142682183
(4-nitrophenyl) N-[5-[N-methyl-4-(trifluoromethyl)anilino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]carbamate (PubChem CID 142682183) has the molecular formula C21H14F3N5O4S and a molecular weight of 489.44 g/mol. Its IUPAC name is (4-nitrophenyl) N-[5-[N-methyl-4-(trifluoromethyl)anilino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]carbamate.
| Compound Name | (4-nitrophenyl) N-[5-[N-methyl-4-(trifluoromethyl)anilino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]carbamate |
|---|---|
| PubChem CID | 142682183 |
| Molecular Formula | C21H14F3N5O4S |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | (4-nitrophenyl) N-[5-[N-methyl-4-(trifluoromethyl)anilino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]carbamate |
| SMILES | CN(c1ccc(C(F)(F)F)cc1)c1ccc2nc(NC(=O)Oc3ccc([N+](=O)[O-])cc3)sc2n1 |
| InChI | InChI=1S/C21H14F3N5O4S/c1-28(13-4-2-12(3-5-13)21(22,23)24)17-11-10-16-18(26-17)34-19(25-16)27-20(30)33-15-8-6-14(7-9-15)29(31)32/h2-11H,1H3,(H,25,27,30) |
| InChIKey | WZDZEFYTAKNFCE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|