C21H28N6O2S — CID 142682136
1-[5-(N,4-dimethylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-[3-[2-hydroxyethyl(methyl)amino]propyl]urea (PubChem CID 142682136) has the molecular formula C21H28N6O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 1-[5-(N,4-dimethylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-[3-[2-hydroxyethyl(methyl)amino]propyl]urea.
| Compound Name | 1-[5-(N,4-dimethylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-[3-[2-hydroxyethyl(methyl)amino]propyl]urea |
|---|---|
| PubChem CID | 142682136 |
| Molecular Formula | C21H28N6O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1-[5-(N,4-dimethylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-[3-[2-hydroxyethyl(methyl)amino]propyl]urea |
| SMILES | Cc1ccc(N(C)c2ccc3nc(NC(=O)NCCCN(C)CCO)sc3n2)cc1 |
| InChI | InChI=1S/C21H28N6O2S/c1-15-5-7-16(8-6-15)27(3)18-10-9-17-19(24-18)30-21(23-17)25-20(29)22-11-4-12-26(2)13-14-28/h5-10,28H,4,11-14H2,1-3H3,(H2,22,23,25,29) |
| InChIKey | YQAHYHTWVMNXIK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|