C20H19F2N7OS — CID 142682123
1-[5-(2,4-difluoro-N-methylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-(3-pyrazol-1-ylpropyl)urea (PubChem CID 142682123) has the molecular formula C20H19F2N7OS and a molecular weight of 443.48 g/mol. Its IUPAC name is 1-[5-(2,4-difluoro-N-methylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-(3-pyrazol-1-ylpropyl)urea.
| Compound Name | 1-[5-(2,4-difluoro-N-methylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-(3-pyrazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 142682123 |
| Molecular Formula | C20H19F2N7OS |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-[5-(2,4-difluoro-N-methylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-(3-pyrazol-1-ylpropyl)urea |
| SMILES | CN(c1ccc2nc(NC(=O)NCCCn3cccn3)sc2n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H19F2N7OS/c1-28(16-6-4-13(21)12-14(16)22)17-7-5-15-18(26-17)31-20(25-15)27-19(30)23-8-2-10-29-11-3-9-24-29/h3-7,9,11-12H,2,8,10H2,1H3,(H2,23,25,27,30) |
| InChIKey | KOMDBOIDQOHMJH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|