C22H26ClFN6O2S — CID 142682180
1-[5-(4-chloro-2-fluoro-N-methylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-[3-(4-hydroxypiperidin-1-yl)propyl]urea (PubChem CID 142682180) has the molecular formula C22H26ClFN6O2S and a molecular weight of 493.01 g/mol. Its IUPAC name is 1-[5-(4-chloro-2-fluoro-N-methylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-[3-(4-hydroxypiperidin-1-yl)propyl]urea.
| Compound Name | 1-[5-(4-chloro-2-fluoro-N-methylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-[3-(4-hydroxypiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 142682180 |
| Molecular Formula | C22H26ClFN6O2S |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 1-[5-(4-chloro-2-fluoro-N-methylanilino)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-[3-(4-hydroxypiperidin-1-yl)propyl]urea |
| SMILES | CN(c1ccc2nc(NC(=O)NCCCN3CCC(O)CC3)sc2n1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C22H26ClFN6O2S/c1-29(18-5-3-14(23)13-16(18)24)19-6-4-17-20(27-19)33-22(26-17)28-21(32)25-9-2-10-30-11-7-15(31)8-12-30/h3-6,13,15,31H,2,7-12H2,1H3,(H2,25,26,28,32) |
| InChIKey | AMQPFLYNUGQHRO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|