C26H23N5O8S2 — CID 142516803
(4-nitrophenyl) N-[3-(tert-butylsulfamoyl)-4-[2-(4-nitrophenyl)-1,3-thiazol-5-yl]phenyl]carbamate (PubChem CID 142516803) has the molecular formula C26H23N5O8S2 and a molecular weight of 597.63 g/mol. Its IUPAC name is (4-nitrophenyl) N-[3-(tert-butylsulfamoyl)-4-[2-(4-nitrophenyl)-1,3-thiazol-5-yl]phenyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[3-(tert-butylsulfamoyl)-4-[2-(4-nitrophenyl)-1,3-thiazol-5-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 142516803 |
| Molecular Formula | C26H23N5O8S2 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.10 |
| IUPAC Name | (4-nitrophenyl) N-[3-(tert-butylsulfamoyl)-4-[2-(4-nitrophenyl)-1,3-thiazol-5-yl]phenyl]carbamate |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(NC(=O)Oc2ccc([N+](=O)[O-])cc2)ccc1-c1cnc(-c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C26H23N5O8S2/c1-26(2,3)29-41(37,38)23-14-17(28-25(32)39-20-11-9-19(10-12-20)31(35)36)6-13-21(23)22-15-27-24(40-22)16-4-7-18(8-5-16)30(33)34/h4-15,29H,1-3H3,(H,28,32) |
| InChIKey | IWSCRQRTIVDZPS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 183.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|