C26H33N5O4S3 — CID 137411908
ethyl N-[3-(tert-butylsulfamoyl)-4-[2-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-5-yl]phenyl]carbamate (PubChem CID 137411908) has the molecular formula C26H33N5O4S3 and a molecular weight of 575.78 g/mol. Its IUPAC name is ethyl N-[3-(tert-butylsulfamoyl)-4-[2-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-5-yl]phenyl]carbamate.
| Compound Name | ethyl N-[3-(tert-butylsulfamoyl)-4-[2-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-5-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 137411908 |
| Molecular Formula | C26H33N5O4S3 |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | ethyl N-[3-(tert-butylsulfamoyl)-4-[2-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-5-yl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(-c2cnc(-c3ccc(NC(=S)NC(C)C)cc3)s2)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C26H33N5O4S3/c1-7-35-25(32)30-19-12-13-20(22(14-19)38(33,34)31-26(4,5)6)21-15-27-23(37-21)17-8-10-18(11-9-17)29-24(36)28-16(2)3/h8-16,31H,7H2,1-6H3,(H,30,32)(H2,28,29,36) |
| InChIKey | IEPODEWTHYSFPT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|