C33H38N6O3S3 — CID 137412027
1-[4-[5-[4-(3-benzyl-2-oxoimidazolidin-1-yl)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]phenyl]-3-propan-2-ylthiourea (PubChem CID 137412027) has the molecular formula C33H38N6O3S3 and a molecular weight of 662.91 g/mol. Its IUPAC name is 1-[4-[5-[4-(3-benzyl-2-oxoimidazolidin-1-yl)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]phenyl]-3-propan-2-ylthiourea.
| Compound Name | 1-[4-[5-[4-(3-benzyl-2-oxoimidazolidin-1-yl)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]phenyl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 137412027 |
| Molecular Formula | C33H38N6O3S3 |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.22 |
| IUPAC Name | 1-[4-[5-[4-(3-benzyl-2-oxoimidazolidin-1-yl)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]phenyl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1ccc(-c2ncc(-c3ccc(N4CCN(Cc5ccccc5)C4=O)cc3S(=O)(=O)NC(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C33H38N6O3S3/c1-22(2)35-31(43)36-25-13-11-24(12-14-25)30-34-20-28(44-30)27-16-15-26(19-29(27)45(41,42)37-33(3,4)5)39-18-17-38(32(39)40)21-23-9-7-6-8-10-23/h6-16,19-20,22,37H,17-18,21H2,1-5H3,(H2,35,36,43) |
| InChIKey | KLRSSXBONQFIHF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|