C23H26N4O3S2 — CID 137408568
2-[2-(4-aminophenyl)-1,3-thiazol-5-yl]-N-tert-butyl-5-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 137408568) has the molecular formula C23H26N4O3S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-1,3-thiazol-5-yl]-N-tert-butyl-5-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | 2-[2-(4-aminophenyl)-1,3-thiazol-5-yl]-N-tert-butyl-5-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 137408568 |
| Molecular Formula | C23H26N4O3S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-[2-(4-aminophenyl)-1,3-thiazol-5-yl]-N-tert-butyl-5-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(N2CCCC2=O)ccc1-c1cnc(-c2ccc(N)cc2)s1 |
| InChI | InChI=1S/C23H26N4O3S2/c1-23(2,3)26-32(29,30)20-13-17(27-12-4-5-21(27)28)10-11-18(20)19-14-25-22(31-19)15-6-8-16(24)9-7-15/h6-11,13-14,26H,4-5,12,24H2,1-3H3 |
| InChIKey | UUHJWCJQRJIXKW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|