C25H31N5O3S3 — CID 137411781
N-[3-(tert-butylsulfamoyl)-4-[5-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-2-yl]phenyl]acetamide (PubChem CID 137411781) has the molecular formula C25H31N5O3S3 and a molecular weight of 545.76 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)-4-[5-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-2-yl]phenyl]acetamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)-4-[5-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 137411781 |
| Molecular Formula | C25H31N5O3S3 |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)-4-[5-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ncc(-c3ccc(NC(=S)NC(C)C)cc3)s2)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C25H31N5O3S3/c1-15(2)27-24(34)29-18-9-7-17(8-10-18)21-14-26-23(35-21)20-12-11-19(28-16(3)31)13-22(20)36(32,33)30-25(4,5)6/h7-15,30H,1-6H3,(H,28,31)(H2,27,29,34) |
| InChIKey | BIUCVQYJNDIDEN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|