C26H32N4O4S2 — CID 146539334
N-[3-(tert-butylsulfamoyl)-4-[2-[4-(5,5-dimethyl-1,3-oxazolidin-3-yl)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide (PubChem CID 146539334) has the molecular formula C26H32N4O4S2 and a molecular weight of 528.70 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)-4-[2-[4-(5,5-dimethyl-1,3-oxazolidin-3-yl)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)-4-[2-[4-(5,5-dimethyl-1,3-oxazolidin-3-yl)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 146539334 |
| Molecular Formula | C26H32N4O4S2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)-4-[2-[4-(5,5-dimethyl-1,3-oxazolidin-3-yl)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cnc(-c3ccc(N4COC(C)(C)C4)cc3)s2)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C26H32N4O4S2/c1-17(31)28-19-9-12-21(23(13-19)36(32,33)29-25(2,3)4)22-14-27-24(35-22)18-7-10-20(11-8-18)30-15-26(5,6)34-16-30/h7-14,29H,15-16H2,1-6H3,(H,28,31) |
| InChIKey | DTFYHPJRJWAFML-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|