C22H24N4O3S3 — CID 142516649
N-[3-(tert-butylsulfamoyl)-4-[5-[4-(methanethioylamino)phenyl]-1,3-thiazol-2-yl]phenyl]acetamide (PubChem CID 142516649) has the molecular formula C22H24N4O3S3 and a molecular weight of 488.66 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)-4-[5-[4-(methanethioylamino)phenyl]-1,3-thiazol-2-yl]phenyl]acetamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)-4-[5-[4-(methanethioylamino)phenyl]-1,3-thiazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 142516649 |
| Molecular Formula | C22H24N4O3S3 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)-4-[5-[4-(methanethioylamino)phenyl]-1,3-thiazol-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ncc(-c3ccc(NC=S)cc3)s2)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C22H24N4O3S3/c1-14(27)25-17-9-10-18(20(11-17)32(28,29)26-22(2,3)4)21-23-12-19(31-21)15-5-7-16(8-6-15)24-13-30/h5-13,26H,1-4H3,(H,24,30)(H,25,27) |
| InChIKey | HOMVCIDQAXKIGS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|