C27H27N5O4S3 — CID 137412023
N-[3-[(4-hydroxyphenyl)sulfamoyl]-4-[2-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide (PubChem CID 137412023) has the molecular formula C27H27N5O4S3 and a molecular weight of 581.75 g/mol. Its IUPAC name is N-[3-[(4-hydroxyphenyl)sulfamoyl]-4-[2-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide.
| Compound Name | N-[3-[(4-hydroxyphenyl)sulfamoyl]-4-[2-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 137412023 |
| Molecular Formula | C27H27N5O4S3 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.12 |
| IUPAC Name | N-[3-[(4-hydroxyphenyl)sulfamoyl]-4-[2-[4-(propan-2-ylcarbamothioylamino)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cnc(-c3ccc(NC(=S)NC(C)C)cc3)s2)c(S(=O)(=O)Nc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C27H27N5O4S3/c1-16(2)29-27(37)31-19-6-4-18(5-7-19)26-28-15-24(38-26)23-13-10-21(30-17(3)33)14-25(23)39(35,36)32-20-8-11-22(34)12-9-20/h4-16,32,34H,1-3H3,(H,30,33)(H2,29,31,37) |
| InChIKey | SDIYVSMFIXXDLK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|